분야별 어휘

분야별 어휘! I. 과학 기술 1. 컴퓨터 download 다운로드 transmit 전송하다 e-mail 이메일 print-out 출력물 encryption 암호화 electronic money 전자화폐 personal computer 개인용 컴퓨터 private information 개인정보 browse the Internet 인터넷을 검색하다 virtual 가상기억의; 실제상의 2. 정보 통신 invent 발명하다 develop 개발하다 technology 기술 high-tech 첨단기술 state-of-the-art technology 최첨단기술 cutting edge technology 첨단기술 sophisticated technique 정교한 솜씨 decode 암호를 판독하다 (=decipher) answering machine 자동응답기 cellular phone 이동전화 mobile phone 이동전화 built-in camera 내장된 카메라 resolution 해상도; 분해능력 intercom 내부통화장치 telecommunication 통신 automate 자동화하다 patent 특허권 infringe 침해하다 II. 자연 환경 1. 천문 orbit 궤도 / 궤도를 돌다 gravity 중력 = gravitation comet 혜성 planet 행성 meteor 운석, 유성 nebula 성운 revolution 공전  * 혁명 rotation 자전 constellation 별자리 lunar eclipse 월식 solar eclipse 일식 astronaut 우주 비행사 spacecraft 우주선 = spaceship explore 탐사하다 astronomer 천문학자 satellite 위성 solar system 태양계 crystal 결정: 수정 fraction 파편 2. 지구환경 exploit 개발하다 radiation 복사; 방사선 infrared rays 적외선 ultraviolet rays 자외선 atmosphere 대기 axis 지축 ecosystem 생태계 ecology 생태학 / 생태 soil 토양 conserve 보호하다 habitat 서식지 canal 운하  strait 해협  Bering strait 베링 해협 continent 대륙 peninsula 반도 latitude 위도 longitude 경도 hemisphere 반구 terrain 지대, 지형 basin 분지 plain 평야, 평원 plateau 고원 coast 해안 erosion 침식 swamp 늪지대 wilderness 황야, 황무지 environment 환경 environmentalist 환경보호론자 global warming 지구온난화 greenhouse effect 온실효과 ozone layer 오존층 glacier 빙하 forest 삼림 deforestation 삼림황폐 desert 사막 desertification 사막화 air pollution 대기오염 car emissions 차량 배기물 exhaust gas 배기가스 carbon dioxide 이산화탄소 acid rain 산성비 biodegradable 생분해성의 water pollution 수질오염 CFCs(chlorofluorocarbons) CFC사염화탄소 chemistry 화학작용 drain 배수하다 recycle 재활용하다 garbage disposal 폐기물처리 disposable items  1회용품 nuclear 원자력의 fallout 방사능 낙진 shelter 방공호, 피난처 hazardous material 위험물질 contaminate 오염시키다 petroleum 석유 crude oil 원유 refined oil 정유 refinery 정제소, 제련소 junk 쓰레기, 폐품 incineration 소각 fume 매연, 가스 exhaust 배기가스; 고갈시키다 disposal 처리; 폐기 3. 날씨 forecast 예보하다 temperature 온도 degrees (온도의)도 Fahrenheit 화씨. 화씨 온도계 Centigrade 섭씨 = Celsius misty 안개 낀 precipitation 강우, 강수, 강설 evaporation 증발 vapor 수증기 water vapor 수증기 drizzle 이슬비 downpour 폭우 lightning 번개 thunderstorm 폭풍우 glacier 빙하 / iceberg 빙산 natural disaster 자연 재해 tornado 회오리바람 *twister cyclone 사이클론, 대폭풍 ; 회오리바람 storm(hurricane, cyclone, typhoon) 폭풍 drought 가뭄 flood 홍수 deluge 대홍수 submerge 잠수 inundation 침수 volcano 화산 eruption 분출 avalanche 눈사태 catastrophe 대참사 calamity 재난, 불행 earthquake 지진 seismologist 지진학자 claim 인명을 앗아가다 devastate 황폐화시키다 erosion 침식 front 전선 turbulence 난기류 sleet 진눈깨비 snowfall 강설 hail 우박 gust 돌풍 gale 강풍 bleak 차가운; 황량한 scorching 몹시 더운 stifling 숨막힐 듯한 muggy 무더운 damp 축축한 moist 촉촉한 humid 눅눅한 4. 생물 species 종 genus  속 (pl. genera) family   과 order   목 class   강 phylum 문 (pl. phyla) kingdom 계 habitat 서식지 rodent 설치류동물(쥐, 토끼, 다람쥐 ..) amphibian 양서류 reproduction 번식 extinction 멸종 conservation 보존 development 개발 sanctuary 성역, 피난처 adaptation 적응력 waste 배설물 III. 정치 1. 선거 candidate 후보자 nominate 후보자로 지명하다 running mate 러닝메이트 electorate 유권자 constituent 선거구민 constituency 선거구 municipal 자치도시의 district 관할구, 지구 election 선거 primary 예비선거 voter 투표자 supporter 지지자  = backer referendum 국민투표 suffrage 투표권 ballot 비밀 투표; 투표용지 vote 투표하다 cast one's ballot =cast one's vote 투표하다 poll 여론조사 landslide 압도적 승리; 산사태 turnout 참석자수, 투표율 inauguration 취임 2. 정부( government), 의회(congress) reign 통치 regime 정권 administration 행정부 federal government 연방정부 central government 중앙정부 empower 권한을 부여하다 cabinet 내각 minister 각료, 장관 secretary 장관 governor 주지사 prime minister 총리 government official 공무원 clout 정치적인 영향력 appoint 임명하다 assign 임무(과제)를 부여하다 head of state 국가원수 Assembly 국회 Parliament (영국)의회 Congress 미국의회 Senate 상원 Senator 상원의원 House of Representatives 하원 Representative 하원의원 legislator 입법자, 국회의원 lawmaker 국회의원 legislation 법률(제정) conservative 보수적인 authorities 당국 incumbent 현직의; 재직자 deputy 대리의; 대리인 aide 보좌관, 조력자 sanction 제가, 승인-s 제재 bill 법안, 의안 propose 제안하다 deliberation 심의 coalition 연합 committee 위원회 subcommittee 소위원회 policy 정책 political party 정당 unanimous 만장일치의 advocate 옹호자 approve 승인하다 session 회기 dissolve 해산하다 dissolve parliament 의회를 해산하다 convene 소집하다 convention 전당 대회 consolidate 통폐합하다 nationality 국적 sovereignty 주권 republic 공화국 economic power 경제 열강 superpower 강대국 handover 이양 separatist 분리주의자 autonomy 자치 colony 식민지 territorial dispute 영토 분쟁 territory 영토 settlement 타결, 정착 bureaucracy 관료제도(정치) democracy 민주주의 capitalism 자본주의 communism 공산주의 socialism 사회주의 3. 외교 diplomacy 외교 diplomat 외교관 embassy 대사관 ambassador 대사관 consulate 영사관 consul 영사 envoy 사절, 특사 delegate 대표자 refugee 난민 deport 추방하다 exiled 추방된, 망명중인 repatriate 본국 송환하다 extradition 외국범인의 인도, 본국송환 charge 책임 contain 저지하다 tension (=strain)긴장 critic 비평가 political asylum 정치적 피난처 ration 식량 배급 starvation 기아 food shortage 식량부족 humanitarian aids 인도주의적 원조 immigration 이민 lift sanctions 제재를 해제하다 impose sanctions 제재를 가하다 agenda 의제 negotiation 협상 representative 대표자 counterpart (협상의)상대자 reservation 보호지역 terms 조건 breakthrough 돌파구 impasse (=deadlock) 교착상태 treaty 조약 pact,(=accord) 협정 agreement 합의 ratify 비준하다 summit conference(talks) 정상회담 talks 회담 riot 폭동 *riot police 전투경찰 rally 집회 protest 항의하다 demonstration 시위 assassinate 암살하다 activist 운동가 dissident 반체제인사 mastermind 배후 조종자 captive 포로 repress 진압하다 crack down on 강경 조치하다 4. 안보 fleet 함대 warship 전함 submarine 잠수함 warplane 전투기 bomber 폭격기 launch 발사하다 conventional weapon 재래식 무기 biochemical weapon 생화학무기 landmines 지뢰(=mine) atomic bomb 원자폭탄 nuclear arsenal 핵무기 troops 지상군, 병력 deterrence 전쟁 억지(력); 제지물 armament 무장 disarmament 무장해제 dismantle 해체하다 deploy 배치하다 serviceman 현역 군인 inspect 사찰 하다 threat 위협 national security 국가 안보 compound 구내, 내부 stability 안정 ally 동맹국 coalition 제휴 collaboration 협력 raid 습격 rebel 반군 air strike 공습 operation 작전 strategy 전략 tactics 전술 mock 모의의 ground war 지상전 warfare 전쟁, 전(戰), 싸움 break out 발발하다 outbreak 발발 clash 충돌 invade 침공하다 state of emergency 비상사태 red alert 적색 경보 territory 영토 occupy 점령하다 surrender 항복하다 withdraw 철수하다 truce 휴전, 정전 *armistice 휴전, 정전 = cease-fire IV. 법 1. 법 provision 규정, 조항; 준비 retroactive 소급 적용되는 enact 법률로 제정하다 amend 법률 등을 수정하다 decree 포고하다, 명하다 enforce 집행하다 constitution 헌법 hearing 청문회, 심리 breach 법률 등의 위반 infringement 위반, 침해 observance 준수 *observe 준수하다 eligible 할 자격이 있는; 적임의 regulation 규제 court 법원 trial 재판 justice 사법; 법관, 판사 jurisdiction 사법, 재판(권) 2. 범죄 drug trafficking 마약 밀거래 smuggle 밀수하다 contraband 밀반입품 corruption 부패 juvenile delinquencies 청소년 비행 culprit 범죄자, 미결수 felon 중죄인 outlaw 불법화하다 arson 방화 stab 칼로 찌르다 threaten 위협하다 extortion 강탈 question 심문하다 violence 폭력 assault 폭행 fugitive 도망자 assassin 암살자 inmate 수감자, 입원자 fraud 사기(꾼) libel 명예 훼손, 모략, 중상 bribery 뇌물 shoplift 절도 homicide 살인(죄) blackmail 공갈, 배상금 conspiracy 음모, 공모 embezzle 횡령하다 kidnap 납치 *hostage 인질 ransom 몸값, 배상금 3. 검거, 재판 crime 범죄 criminal 범인 suspect 용의자 fugitive 탈주자 custody 구금, 양육권 release 석방하다 detain 억류하다 arrest 체포하다 search 수색하다 investigation 수사 identification 신원 확인 witness 목격하다, 목격자 testify 증언하다 testimony 증언 take an oath 선서하다 evidence 증거 file 신청하다 indict 기소하다 impeach 탄핵하다 allegation 진술, 주장 allegedly 주장에 따르면 plea 탄원, 항변 petition 청원(탄원)하다 sue 고소하다 countersuit 맞고소 lawsuit 소송 prosecution 기소 defendant 피고 plaintiff 원고 prosecutor 검사 judge 판사 attorney 변호사(=lawyer) jury 배심 verdict 평결, 판결 convict 유죄를 선고하다 acquit 무죄를 선고하다 not guilty 무죄의 imprisonment 투옥 capital punishment 극형 parole 가석방 bail 보석금 fine 벌금 confiscate 몰수하다 forfeit (재산, 권리를)상실하다; 벌금 settlement(소송의)화해 V. 경제 1. 경제일반      economics 경제학 market economy 시장경제 gross 총계의,총수익을 올리다 GNP 국민총생산 (Gross National Product) domestic 국내의 GDP 국내총생산 (Gross Domestic Product) infrastructure 산업기반 production 생산 productivity 생산성 economic growth 경제성장 manufacturer 제조업자 output 생산,산출(↔input) merchandise 상품 2. 무역 barter 물물교환 하다 shipment 선적 trade barrier 무역장벽 trade imbalance 무역불균등 trade friction 무역마찰 accumulation 축적,누적 purchase 구매하다 distribution 유통 surplus 흑자 deficit 적자 tariff 관세 embargo 통상금지 3. 경기 stable 안정된 fluctuate 변동하다 stimulate 자극하다 boom 호황, 벼락경기 brisk 경기가 활기있는, 기운찬 sluggish 불경기의, 게으른 slack 침체된, 한산한 downturn 경기하강,침체 recession 경기후퇴 depression 불경기,(De- 공황) stagnation 경기침체 panic 경제공황 plummet 물가가 곤두박질치다 consumer 소비자 consumer price 소비자물가 expenditure 지출,경비 thrift 검약,검소 frugal 절약하는 lavish 낭비하는 bankrupt 파산한 collapse 도산하다 shutdown 공장의 폐쇄 4.재정과 통화 budget 예산 lucrative 수지가 맞는 proceeds 매상고, 수익 assets 자산,재산 privatization 민영화 privatize 민영화하다 nationalize 국유화하다 fiscal 재정의, 회계의 fiscal year 회계년도 assess (재산을) 평가하다 revenue (회사, 국가등의) 총수입 expenditure (=spending)지출 turnover 판매고 capital 자본금 bankrupt 파산한 rating 신용등급, 평가 treasurer 회계 담당자 accountant 회계원 allow 지급하다 wage 임금(=salary) audit 회계감사 appraise 자산 등을 감정하다 liquidate (빚을)청산하다;(빚을 갚으려고 재산을) 처분하다 bankrupt 파산한 monetary 화폐의, 금융상의 bill 지폐, 계산서 currency 통화 currency exchange 환율 currency market 외환 시장 electronic money 전자 화폐 fake 위조품, 모조의;모조하다 bogus위조품, 모조의 counterfeit 위조품, 모조의 denomination 금전의 액면가, 단위 endorse 수표에 이서 하다 bounce 수표가 부도나서 되돌아오다 appreciation 평가절상 depreciation 평가절하 5. 거래, 계약 wholesale 도매의 retail 소매의 auction 경매 bid 입찰 tender 입찰하다 brokerage 중개업 trustee 수탁인, 비신탁인 creditor 채권자(↔debtor) stipulation 계약 조건 expire 계약들이 만료되다 commission 수수료; 위임하다 default 채무를 이행하지 않다 6. 재산 property 재산 taxation 과세 taxpayer 납세자 levy (세금을) 부과하다 deduct (세금을) 공제하다 income tax 소득세 corporate tax 법인세 direct tax 직접세 indirect tax 간접세 convert 환전하다 convertible 환전할 수 있는 tax raise 세금 인상 tax-free 면세 tax evasion 탈세 tax dodge 탈세 legacy 유산 real estate 부동산 premises 토지, 대지 speculation 투기 tenure 재산의 보유기간, 재직기간 tenant 임차인 lease (건물 등의)임대계약 collateral 담보로한;담보물 mortgage 주택저당대출 loan 대출 liable 책임져야할 liabilities 부채 interest rate 금리 7. 은행과 보험 financial institution 금융기관 deposit 예금(하다) withdraw 인출하다 passbook 통장 balance 잔고 principal 원금 accrue 이자 등이 붙다 service 이자를 주다 cumulative 누적하는 remittance 송금된 돈 delinquent 체납되어 있는 overdue 기한이 지난 checking account 당좌예금계좌 bank account 은행 계좌 savings 저축 secret code 비밀번호 pension 연금 benefit 수당 beneficiary 수령인 recipient 수령인,수혜자 insurer 보험회사, 보험업자 insurant 보험가입자,피보험자 insurance company 보험회사 automobile insurance 자동차모험 damage insurance 손해보험 medical insurance 의료보험 unemployment insurance 의료보험 policy 보험증서 surrender 보험해약 coverage 보험의 보상범위 8. 기업 corporation 주식회사, 법인 incorporated 법인의 conglomerate 복합기업 entrepreneur 진취적 기업가 chairman 회장 CEO 최고경영자 (Chief Executive Officer) tycoon 거물급 기업가 headquarters 본사, 본부 subsidiary 자회사, 계열사 executive 간부, 임원 board 이사회 division 부, 국 securities 유가증권 securities company 증권회사 stockholder 주주 shareholder 주주 stockmarket 주식시장 bond 채권 allotment 할당금 dividend 이익배당금 9. 관리, 경영 boost 증대시키다 restructure 구조 조정하다 layoff 정리 해고 fire 해고하다 dismiss 해고하다 strike 파업(=walkout) labor union 노동조합 workload 표준 작업량 downsizing 기업규모를 축소함 overhead 경상비, 고정비 curtail 삭감하다 cutback 축소, 삭감 streamline 합리화(간소화)하다 transact 행하다, 처리하다 invoice 송장(送狀) reimburse 배상(변제)하다 merge 합병하다 consolidate 합병하다 coalition 연립 strategic alliance 전략적 제휴 takeover 인수 expansion 확장  10. 채용 employ 고용하다 hire 채용하다 unemployment 실업 applicant 지원자, 신청자 recruit 신입 회원 5-day workweek system 주5일근무제 certificate 자격증, 증명서 qualify 자격을 주다 qualification 자격 요건 aptitude 적성, 소질 adept 숙련된 personnel 인사담당부서 colleague 동료 designate  임명하다 predecessor 전임자 successor 후임자       VI. 의학 cell 세포 tissue 조직 nerve 신경 gene 유전자 genome 게놈 DNA 디옥시리보 핵산 clone 클론 (영양생식에 의하여 모체로부터 분리증식한 식물군) blood circulation 혈액순환 life expectancy 평균수명 womb 자궁 pregnancy 임신 surrogate mother 대리모 sterilization 불임화 infertility 불임 miscarriage 유산 abortion 낙태 birth control 산아제한 contraception 피임 contraceptive 피임약 gene therapy 유전자 치료 relapse 재발 leukemia 백혈병 cancer 암  terminal cancer 말기암 incubation period 잠복기 negative 음성 positive 양성 tumor 종양 polyp 혹,폴립 allergy 알레르기 dust 먼지 mite 진드기 burn 화상 bruise 타박상 abrasion 찰과상 dislocation 탈구 sprain 삠 fracture 골절 injury 상해 cut 창상 arthritis 관절염 neuralgia 신경통 spasm 경련 pain 통증 back pain 요통 rheumatism 류머티즘 brain death 뇌사 blood pressure 혈압 temperature 체온 medical examination 검진 urine 소변 vaccine 백신 diagnose 병을 진단하다 inoculation (예방)접종 medication 약품 ointment 연고 over-the-counter 의사의 처방 없이 판매할 수 있는 under prescription 처방전이 필요한 recover 회복하다 surgery 외과수술 anaesthesia 마취 shot 주사 acute 급성의 chronic 만성의 germ 세균 immune 면역성의 ailment 병 epidemic 유행성 전염병 contagious disease 전염병 onset 병의 발병 plague 전염병; 페스트 treatment 치료 therapy(수술과 약물치료를 제외한)요법 medication 약물 치료, 약물 longevity 장수; 수명 malpractice 의료과실 clinic 진료소 general hospital 종합병원 health center 보건소 public health authorities 보건당국 pharmacy 약국 ICU(Intensive Care Unit)중환자실 Medicare 노인의료보험 Medicaid (저속득자, 장애자를 위한) 국민의료 보장제도 medical cost 의료비 hospitalize 입원시키다 discharge 퇴원시키다 physician 내과의사 surgeon 외과의사 dentist 치과 의사 medical specialist 전문의 psychiatrist 정신과 의사 patient 환자 the disabled 장애자 the handicapped 장애자 VII. 건강 1. 신체 physique 체격 corporal 신체의 muscle 근육 flexibility 유연성 improvisation 순발력 adaptation 적응력 agility 민첩성 endurance 지구력 robust 건장한 stout 살찐 obese 비만의 overweight 과체중 exercise 운동, 훈련 stretching 스트레칭 fitness 몸매가꾸기 weight training 근력 운동 lose weight 살이 빠지다 metabolism 신진대사 respiratory 호흡기의 inhale 숨을 들이키다 exhale 숨을 내쉬다 perspire 발한하다 sweat 땀 fatigue 피로 crippled 불구의 hoarse 목소리가 쉰 quit smoking 담배를 끊다 secondhand smoking 간접 흡연 passive smoke 간접 흡연자 excessive smoking 과도한 흡연 unsanitary 비위생적인 2.음식 cuisine 요리 recipe 요리 비법 seasoning 양념 simmer 부글부글 끓이다 broil 굽다 mash 짓이기다 mellow 달콤한 stale 상한 vapid 김빠진 diet 식단 dietitian 영양사 nourish 영양분을 주다 nutrition 영양; 음식물 malnutrition 영양실조 nutrient 영양제 fat 지방 protein 단백질 amino acid 아미노산 acid 산 extract 추출액 enzyme 효소 sodium 나트륨 processed food 가공 식품 canned food 통조림 식품 organic food 유기농 식품 GMO (Genetically Modified Food) 유전자 조작식품 natural food 자연식 edible 식용의 grain 곡물 wheat 밀 barley 보리 soybean 콩 ferment 효모, 발효 low-fat milk 저지방유 dairy product 유제품 soda 탄산음료 tap water 수돗물 rib 갈비 poultry 가금류(닭,칠면조 같은) cater 파티에 음식물을 제공하다 brew 커피 끓이다; 맥주 등을 양조하다 intoxicate 술등으로 취하게 하다 hangover 숙취 sober 술취하지않은 8. 수학물리 impulse 충격 reaction 반작용 particle입자 combination 조합 atom 원자 molecule 분자 donor (전자)공여체 diameter 직경,지름 radius 반지름 root 근(根) square 제곱 perspective 원근법 refraction 굴절 velocity 속도 2. 집 appliance 가정용기구 corridor 복도 fixture 내부시설물, 비품 closet 작은방, 수납실, 벽장 3. 패션 costume 복장, 의상 garment 의류 wardrobe 의상, 옷장 dress-up 정장 shabby 낡은, 남루한